C15H17N3O3S — CID 99783059
N-[[4-(methoxymethyl)phenyl]methyl]-N'-(3-methyl-1,2-thiazol-5-yl)oxamide (PubChem CID 99783059) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[[4-(methoxymethyl)phenyl]methyl]-N'-(3-methyl-1,2-thiazol-5-yl)oxamide.
| Compound Name | N-[[4-(methoxymethyl)phenyl]methyl]-N'-(3-methyl-1,2-thiazol-5-yl)oxamide |
|---|---|
| PubChem CID | 99783059 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-[[4-(methoxymethyl)phenyl]methyl]-N'-(3-methyl-1,2-thiazol-5-yl)oxamide |
| SMILES | COCc1ccc(CNC(=O)C(=O)Nc2cc(C)ns2)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c1-10-7-13(22-18-10)17-15(20)14(19)16-8-11-3-5-12(6-4-11)9-21-2/h3-7H,8-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | JMMZPRMKPBGTQM-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|