C17H19N3O4 — CID 99783279
N-[2-[[(2R)-1-hydroxypent-4-en-2-yl]amino]-2-oxoethyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 99783279) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[2-[[(2R)-1-hydroxypent-4-en-2-yl]amino]-2-oxoethyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[[(2R)-1-hydroxypent-4-en-2-yl]amino]-2-oxoethyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 99783279 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[2-[[(2R)-1-hydroxypent-4-en-2-yl]amino]-2-oxoethyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | C=CC[C@H](CO)NC(=O)CNC(=O)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C17H19N3O4/c1-2-6-13(11-21)19-16(22)10-18-17(23)14-9-15(24-20-14)12-7-4-3-5-8-12/h2-5,7-9,13,21H,1,6,10-11H2,(H,18,23)(H,19,22)/t13-/m1/s1 |
| InChIKey | XKDDHGANKBRDBZ-CYBMUJFWSA-N |
| XLogP | 1.12 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|