C14H13ClN4O2 — CID 99783817
(2S)-2-[(6-chloro-4-cyanoquinolin-2-yl)amino]-3-hydroxy-N-methylpropanamide (PubChem CID 99783817) has the molecular formula C14H13ClN4O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is (2S)-2-[(6-chloro-4-cyanoquinolin-2-yl)amino]-3-hydroxy-N-methylpropanamide.
| Compound Name | (2S)-2-[(6-chloro-4-cyanoquinolin-2-yl)amino]-3-hydroxy-N-methylpropanamide |
|---|---|
| PubChem CID | 99783817 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | (2S)-2-[(6-chloro-4-cyanoquinolin-2-yl)amino]-3-hydroxy-N-methylpropanamide |
| SMILES | CNC(=O)[C@H](CO)Nc1cc(C#N)c2cc(Cl)ccc2n1 |
| InChI | InChI=1S/C14H13ClN4O2/c1-17-14(21)12(7-20)19-13-4-8(6-16)10-5-9(15)2-3-11(10)18-13/h2-5,12,20H,7H2,1H3,(H,17,21)(H,18,19)/t12-/m0/s1 |
| InChIKey | YBCWNDZWSPZRGJ-LBPRGKRZSA-N |
| XLogP | 1.28 |
| TPSA | 98.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |