About (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate
(3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate (PubChem CID 99784385) has the molecular formula C15H13N3O5
and a molecular weight of 315.29 g/mol. Its IUPAC name is (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate.
Molecular Properties
| Compound Name | (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate |
| PubChem CID | 99784385 |
| Molecular Formula | C15H13N3O5 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1c(C(=O)Oc2cccc(C(N)=O)c2)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13N3O5/c1-17-13-11(6-3-7-12(13)18(21)22)15(20)23-10-5-2-4-9(8-10)14(16)19/h2-8,17H,1H3,(H2,16,19) |
| InChIKey | XWWQMAKFJSAWOB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate?
The IUPAC name of (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate (CID 99784385) is (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate.
What is the SMILES notation for (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate?
The canonical SMILES for (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate is CNc1c(C(=O)Oc2cccc(C(N)=O)c2)cccc1[N+](=O)[O-].
What is the InChIKey of (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate?
The InChIKey is XWWQMAKFJSAWOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O5/c1-17-13-11(6-3-7-12(13)18(21)22)15(20)23-10-5-2-4-9(8-10)14(16)19/h2-8,17H,1H3,(H2,16,19).
What are the key properties of (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate?
(3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate has a molecular weight of 315.29 g/mol, XLogP of 1.95, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3-carbamoylphenyl) 2-(methylamino)-3-nitrobenzoate is sourced from PubChem (CID 99784385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).