C20H23N3O4 — CID 99784507
1-N-cyclopropyl-4-N-[(1S)-2,2-dimethoxy-1-pyridin-3-ylethyl]benzene-1,4-dicarboxamide (PubChem CID 99784507) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 1-N-cyclopropyl-4-N-[(1S)-2,2-dimethoxy-1-pyridin-3-ylethyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N-cyclopropyl-4-N-[(1S)-2,2-dimethoxy-1-pyridin-3-ylethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 99784507 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-N-cyclopropyl-4-N-[(1S)-2,2-dimethoxy-1-pyridin-3-ylethyl]benzene-1,4-dicarboxamide |
| SMILES | COC(OC)[C@@H](NC(=O)c1ccc(C(=O)NC2CC2)cc1)c1cccnc1 |
| InChI | InChI=1S/C20H23N3O4/c1-26-20(27-2)17(15-4-3-11-21-12-15)23-19(25)14-7-5-13(6-8-14)18(24)22-16-9-10-16/h3-8,11-12,16-17,20H,9-10H2,1-2H3,(H,22,24)(H,23,25)/t17-/m0/s1 |
| InChIKey | LSLDOSAIGLZYLG-KRWDZBQOSA-N |
| XLogP | 2.06 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|