C18H27N3O4S — CID 99785364
N-[(1S)-1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-[(2S)-2-ethylpyrrolidin-1-yl]-2-oxoacetamide (PubChem CID 99785364) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is N-[(1S)-1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-[(2S)-2-ethylpyrrolidin-1-yl]-2-oxoacetamide.
| Compound Name | N-[(1S)-1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-[(2S)-2-ethylpyrrolidin-1-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 99785364 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(1S)-1-[4-(dimethylsulfamoyl)phenyl]ethyl]-2-[(2S)-2-ethylpyrrolidin-1-yl]-2-oxoacetamide |
| SMILES | CC[C@H]1CCCN1C(=O)C(=O)N[C@@H](C)c1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C18H27N3O4S/c1-5-15-7-6-12-21(15)18(23)17(22)19-13(2)14-8-10-16(11-9-14)26(24,25)20(3)4/h8-11,13,15H,5-7,12H2,1-4H3,(H,19,22)/t13-,15-/m0/s1 |
| InChIKey | ZKXDRSRKKHJFAS-ZFWWWQNUSA-N |
| XLogP | 1.52 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|