About 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide
1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide (PubChem CID 99786412) has the molecular formula C18H29N3O2
and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide.
Molecular Properties
| Compound Name | 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide |
| PubChem CID | 99786412 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide |
| SMILES | CC(C)C[C@H]1OCCC[C@H]1NC(=O)c1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C18H29N3O2/c1-13(2)12-17-15(8-5-11-23-17)19-18(22)16-9-10-21(20-16)14-6-3-4-7-14/h9-10,13-15,17H,3-8,11-12H2,1-2H3,(H,19,22)/t15-,17-/m1/s1 |
| InChIKey | MMYIFMSPALFVIU-NVXWUHKLSA-N |
| XLogP | 3.32 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide?
The IUPAC name of 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide (CID 99786412) is 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide.
What is the SMILES notation for 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide?
The canonical SMILES for 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide is CC(C)C[C@H]1OCCC[C@H]1NC(=O)c1ccn(C2CCCC2)n1.
What is the InChIKey of 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide?
The InChIKey is MMYIFMSPALFVIU-NVXWUHKLSA-N. The full InChI is InChI=1S/C18H29N3O2/c1-13(2)12-17-15(8-5-11-23-17)19-18(22)16-9-10-21(20-16)14-6-3-4-7-14/h9-10,13-15,17H,3-8,11-12H2,1-2H3,(H,19,22)/t15-,17-/m1/s1.
What are the key properties of 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide?
1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide has a molecular weight of 319.45 g/mol, XLogP of 3.32, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-N-[(2R,3R)-2-(2-methylpropyl)oxan-3-yl]pyrazole-3-carboxamide is sourced from PubChem (CID 99786412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).