C14H15IN2OS — CID 99787814
N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-3-iodo-4-methylbenzamide (PubChem CID 99787814) has the molecular formula C14H15IN2OS and a molecular weight of 386.26 g/mol. Its IUPAC name is N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-3-iodo-4-methylbenzamide.
| Compound Name | N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-3-iodo-4-methylbenzamide |
|---|---|
| PubChem CID | 99787814 |
| Molecular Formula | C14H15IN2OS |
| Molecular Weight | 386.26 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | N-(2-ethyl-4-methyl-1,3-thiazol-5-yl)-3-iodo-4-methylbenzamide |
| SMILES | CCc1nc(C)c(NC(=O)c2ccc(C)c(I)c2)s1 |
| InChI | InChI=1S/C14H15IN2OS/c1-4-12-16-9(3)14(19-12)17-13(18)10-6-5-8(2)11(15)7-10/h5-7H,4H2,1-3H3,(H,17,18) |
| InChIKey | UWUHOELNCVKSSD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.26 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|