C13H12ClN3O2S — CID 166419760
5-[(4-chlorobenzoyl)amino]-2-ethyl-1,3-thiazole-4-carboxamide (PubChem CID 166419760) has the molecular formula C13H12ClN3O2S and a molecular weight of 309.78 g/mol. Its IUPAC name is 5-[(4-chlorobenzoyl)amino]-2-ethyl-1,3-thiazole-4-carboxamide.
| Compound Name | 5-[(4-chlorobenzoyl)amino]-2-ethyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 166419760 |
| Molecular Formula | C13H12ClN3O2S |
| Molecular Weight | 309.78 g/mol |
| Exact Mass | 309.03 |
| IUPAC Name | 5-[(4-chlorobenzoyl)amino]-2-ethyl-1,3-thiazole-4-carboxamide |
| SMILES | CCc1nc(C(N)=O)c(NC(=O)c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C13H12ClN3O2S/c1-2-9-16-10(11(15)18)13(20-9)17-12(19)7-3-5-8(14)6-4-7/h3-6H,2H2,1H3,(H2,15,18)(H,17,19) |
| InChIKey | MIQZKYRIBRFNKS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |