C24H39N3O3 — CID 99788115
tert-butyl (3R)-3-[2-[4-(2-phenoxyethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate (PubChem CID 99788115) has the molecular formula C24H39N3O3 and a molecular weight of 417.59 g/mol. Its IUPAC name is tert-butyl (3R)-3-[2-[4-(2-phenoxyethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[2-[4-(2-phenoxyethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 99788115 |
| Molecular Formula | C24H39N3O3 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.30 |
| IUPAC Name | tert-butyl (3R)-3-[2-[4-(2-phenoxyethyl)piperazin-1-yl]ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](CCN2CCN(CCOc3ccccc3)CC2)C1 |
| InChI | InChI=1S/C24H39N3O3/c1-24(2,3)30-23(28)27-12-7-8-21(20-27)11-13-25-14-16-26(17-15-25)18-19-29-22-9-5-4-6-10-22/h4-6,9-10,21H,7-8,11-20H2,1-3H3/t21-/m1/s1 |
| InChIKey | TZHHDYLYCHYHPN-OAQYLSRUSA-N |
| XLogP | 3.72 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |