C20H30N2O3 — CID 99789288
cis-(1S,3R)-3-hydroxy-N-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]cyclohexane-1-carboxamide (PubChem CID 99789288) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is cis-(1S,3R)-3-hydroxy-N-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]cyclohexane-1-carboxamide.
| Compound Name | cis-(1S,3R)-3-hydroxy-N-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 99789288 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | cis-(1S,3R)-3-hydroxy-N-[[4-[4-(hydroxymethyl)piperidin-1-yl]phenyl]methyl]cyclohexane-1-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCC(CO)CC2)cc1)[C@H]1CCC[C@@H](O)C1 |
| InChI | InChI=1S/C20H30N2O3/c23-14-16-8-10-22(11-9-16)18-6-4-15(5-7-18)13-21-20(25)17-2-1-3-19(24)12-17/h4-7,16-17,19,23-24H,1-3,8-14H2,(H,21,25)/t17-,19+/m0/s1 |
| InChIKey | UHKQOAVVGASMKH-PKOBYXMFSA-N |
| XLogP | 2.06 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|