About [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone
[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone (PubChem CID 99789765) has the molecular formula C14H15F2NO2
and a molecular weight of 267.27 g/mol. Its IUPAC name is [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone.
Molecular Properties
| Compound Name | [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone |
| PubChem CID | 99789765 |
| Molecular Formula | C14H15F2NO2 |
| Molecular Weight | 267.27 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone |
| SMILES | O=C([C@H]1C[C@H]1c1ccc(F)c(F)c1)N1CCCCO1 |
| InChI | InChI=1S/C14H15F2NO2/c15-12-4-3-9(7-13(12)16)10-8-11(10)14(18)17-5-1-2-6-19-17/h3-4,7,10-11H,1-2,5-6,8H2/t10-,11-/m0/s1 |
| InChIKey | QEWCRFFRVIEUDK-QWRGUYRKSA-N |
| XLogP | 2.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone?
The IUPAC name of [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone (CID 99789765) is [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone.
What is the SMILES notation for [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone?
The canonical SMILES for [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone is O=C([C@H]1C[C@H]1c1ccc(F)c(F)c1)N1CCCCO1.
What is the InChIKey of [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone?
The InChIKey is QEWCRFFRVIEUDK-QWRGUYRKSA-N. The full InChI is InChI=1S/C14H15F2NO2/c15-12-4-3-9(7-13(12)16)10-8-11(10)14(18)17-5-1-2-6-19-17/h3-4,7,10-11H,1-2,5-6,8H2/t10-,11-/m0/s1.
What are the key properties of [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone?
[(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone has a molecular weight of 267.27 g/mol, XLogP of 2.62, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-(3,4-difluorophenyl)cyclopropyl]-(oxazinan-2-yl)methanone is sourced from PubChem (CID 99789765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).