C17H17N3O4 — CID 99790211
N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-1H-indole-2-carboxamide (PubChem CID 99790211) has the molecular formula C17H17N3O4 and a molecular weight of 327.34 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-1H-indole-2-carboxamide.
| Compound Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 99790211 |
| Molecular Formula | C17H17N3O4 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)-2-oxoethyl]-5-methoxy-1H-indole-2-carboxamide |
| SMILES | COc1ccc2[nH]c(C(=O)NCC(=O)NCc3ccco3)cc2c1 |
| InChI | InChI=1S/C17H17N3O4/c1-23-12-4-5-14-11(7-12)8-15(20-14)17(22)19-10-16(21)18-9-13-3-2-6-24-13/h2-8,20H,9-10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ULVUPTNEMYAQLU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |