C15H16N4O3S — CID 99790654
2-amino-N-[(7R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-5-nitrobenzamide (PubChem CID 99790654) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-amino-N-[(7R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-5-nitrobenzamide.
| Compound Name | 2-amino-N-[(7R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 99790654 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-amino-N-[(7R)-2-methyl-4,5,6,7-tetrahydro-1,3-benzothiazol-7-yl]-5-nitrobenzamide |
| SMILES | Cc1nc2c(s1)[C@H](NC(=O)c1cc([N+](=O)[O-])ccc1N)CCC2 |
| InChI | InChI=1S/C15H16N4O3S/c1-8-17-12-3-2-4-13(14(12)23-8)18-15(20)10-7-9(19(21)22)5-6-11(10)16/h5-7,13H,2-4,16H2,1H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | SADKMBSTHCLMBN-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|