C16H20N4O3 — CID 99790995
ethyl (2S)-2-methyl-2-phenyl-3-[[2-(triazol-1-yl)acetyl]amino]propanoate (PubChem CID 99790995) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl (2S)-2-methyl-2-phenyl-3-[[2-(triazol-1-yl)acetyl]amino]propanoate.
| Compound Name | ethyl (2S)-2-methyl-2-phenyl-3-[[2-(triazol-1-yl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 99790995 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | ethyl (2S)-2-methyl-2-phenyl-3-[[2-(triazol-1-yl)acetyl]amino]propanoate |
| SMILES | CCOC(=O)[C@](C)(CNC(=O)Cn1ccnn1)c1ccccc1 |
| InChI | InChI=1S/C16H20N4O3/c1-3-23-15(22)16(2,13-7-5-4-6-8-13)12-17-14(21)11-20-10-9-18-19-20/h4-10H,3,11-12H2,1-2H3,(H,17,21)/t16-/m1/s1 |
| InChIKey | SFHJRDBMHFRFDW-MRXNPFEDSA-N |
| XLogP | 0.92 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |