C16H12F3N3O2 — CID 99793440
N-[(R)-cyano-(2-methoxyphenyl)methyl]-2-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 99793440) has the molecular formula C16H12F3N3O2 and a molecular weight of 335.29 g/mol. Its IUPAC name is N-[(R)-cyano-(2-methoxyphenyl)methyl]-2-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-[(R)-cyano-(2-methoxyphenyl)methyl]-2-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 99793440 |
| Molecular Formula | C16H12F3N3O2 |
| Molecular Weight | 335.29 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | N-[(R)-cyano-(2-methoxyphenyl)methyl]-2-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | COc1ccccc1[C@H](C#N)NC(=O)c1cccnc1C(F)(F)F |
| InChI | InChI=1S/C16H12F3N3O2/c1-24-13-7-3-2-5-10(13)12(9-20)22-15(23)11-6-4-8-21-14(11)16(17,18)19/h2-8,12H,1H3,(H,22,23)/t12-/m0/s1 |
| InChIKey | QAXXVTNLCQPCCM-LBPRGKRZSA-N |
| XLogP | 3.10 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |