C18H18N2O3 — CID 95769630
N-[(S)-cyano-(2-methylphenyl)methyl]-2,5-dimethoxybenzamide (PubChem CID 95769630) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is N-[(S)-cyano-(2-methylphenyl)methyl]-2,5-dimethoxybenzamide.
| Compound Name | N-[(S)-cyano-(2-methylphenyl)methyl]-2,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 95769630 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | N-[(S)-cyano-(2-methylphenyl)methyl]-2,5-dimethoxybenzamide |
| SMILES | COc1ccc(OC)c(C(=O)N[C@H](C#N)c2ccccc2C)c1 |
| InChI | InChI=1S/C18H18N2O3/c1-12-6-4-5-7-14(12)16(11-19)20-18(21)15-10-13(22-2)8-9-17(15)23-3/h4-10,16H,1-3H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | OZHXOQAZCWRCPJ-MRXNPFEDSA-N |
| XLogP | 3.01 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |