C22H29N3O3 — CID 99794215
(4aR,7aR)-1-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 99794215) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is (4aR,7aR)-1-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (4aR,7aR)-1-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 99794215 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | (4aR,7aR)-1-[1-(3-phenylpropanoyl)piperidine-4-carbonyl]-3,4,4a,6,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | O=C1NC[C@H]2[C@H]1CCCN2C(=O)C1CCN(C(=O)CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c26-20(9-8-16-5-2-1-3-6-16)24-13-10-17(11-14-24)22(28)25-12-4-7-18-19(25)15-23-21(18)27/h1-3,5-6,17-19H,4,7-15H2,(H,23,27)/t18-,19+/m1/s1 |
| InChIKey | OWOKKVDIBSQTPL-MOPGFXCFSA-N |
| XLogP | 1.59 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |