C15H18O2S2 — CID 99795007
2-[(1R)-1-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]ethyl]thiophene (PubChem CID 99795007) has the molecular formula C15H18O2S2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-[(1R)-1-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]ethyl]thiophene.
| Compound Name | 2-[(1R)-1-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]ethyl]thiophene |
|---|---|
| PubChem CID | 99795007 |
| Molecular Formula | C15H18O2S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-[(1R)-1-[(S)-2-(4-methoxyphenyl)ethylsulfinyl]ethyl]thiophene |
| SMILES | COc1ccc(CC[S@](=O)[C@H](C)c2cccs2)cc1 |
| InChI | InChI=1S/C15H18O2S2/c1-12(15-4-3-10-18-15)19(16)11-9-13-5-7-14(17-2)8-6-13/h3-8,10,12H,9,11H2,1-2H3/t12-,19+/m1/s1 |
| InChIKey | ZXHYIAWSICHEBD-BLVKFPJESA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |