C17H19N3O2S — CID 99796637
(3R)-3-[(1-ethylbenzimidazol-2-yl)methylamino]-3-thiophen-3-ylpropanoic acid (PubChem CID 99796637) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (3R)-3-[(1-ethylbenzimidazol-2-yl)methylamino]-3-thiophen-3-ylpropanoic acid.
| Compound Name | (3R)-3-[(1-ethylbenzimidazol-2-yl)methylamino]-3-thiophen-3-ylpropanoic acid |
|---|---|
| PubChem CID | 99796637 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (3R)-3-[(1-ethylbenzimidazol-2-yl)methylamino]-3-thiophen-3-ylpropanoic acid |
| SMILES | CCn1c(CN[C@H](CC(=O)O)c2ccsc2)nc2ccccc21 |
| InChI | InChI=1S/C17H19N3O2S/c1-2-20-15-6-4-3-5-13(15)19-16(20)10-18-14(9-17(21)22)12-7-8-23-11-12/h3-8,11,14,18H,2,9-10H2,1H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | JTBCCKCLQUBNFV-CQSZACIVSA-N |
| XLogP | 3.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |