C16H19ClN4O4 — CID 99801253
N-(5-chloro-2-methoxyphenyl)-2-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]acetamide (PubChem CID 99801253) has the molecular formula C16H19ClN4O4 and a molecular weight of 366.81 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]acetamide |
|---|---|
| PubChem CID | 99801253 |
| Molecular Formula | C16H19ClN4O4 |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[(5S)-2,4-dioxo-1,3,9-triazaspiro[4.5]decan-9-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN1CCC[C@@]2(C1)NC(=O)NC2=O |
| InChI | InChI=1S/C16H19ClN4O4/c1-25-12-4-3-10(17)7-11(12)18-13(22)8-21-6-2-5-16(9-21)14(23)19-15(24)20-16/h3-4,7H,2,5-6,8-9H2,1H3,(H,18,22)(H2,19,20,23,24)/t16-/m0/s1 |
| InChIKey | NDVDHBYCRYYSEH-INIZCTEOSA-N |
| XLogP | 0.96 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|