C21H22ClN5O4 — CID 156590965
N-(5-chloro-2-methoxyphenyl)-2-[8-(4-methylphenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide (PubChem CID 156590965) has the molecular formula C21H22ClN5O4 and a molecular weight of 443.89 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-2-[8-(4-methylphenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-2-[8-(4-methylphenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide |
|---|---|
| PubChem CID | 156590965 |
| Molecular Formula | C21H22ClN5O4 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-2-[8-(4-methylphenyl)-3,4-dioxo-1,6,7,8a-tetrahydroimidazo[2,1-c][1,2,4]triazin-2-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN1NC2N(CCN2c2ccc(C)cc2)C(=O)C1=O |
| InChI | InChI=1S/C21H22ClN5O4/c1-13-3-6-15(7-4-13)25-9-10-26-19(29)20(30)27(24-21(25)26)12-18(28)23-16-11-14(22)5-8-17(16)31-2/h3-8,11,21,24H,9-10,12H2,1-2H3,(H,23,28) |
| InChIKey | UELPPCICPCMQRY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|