C16H18ClFN4O2 — CID 99801692
N'-[1-[(2R)-butan-2-yl]-5-methylpyrazol-3-yl]-N-(5-chloro-2-fluorophenyl)oxamide (PubChem CID 99801692) has the molecular formula C16H18ClFN4O2 and a molecular weight of 352.80 g/mol. Its IUPAC name is N'-[1-[(2R)-butan-2-yl]-5-methylpyrazol-3-yl]-N-(5-chloro-2-fluorophenyl)oxamide.
| Compound Name | N'-[1-[(2R)-butan-2-yl]-5-methylpyrazol-3-yl]-N-(5-chloro-2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 99801692 |
| Molecular Formula | C16H18ClFN4O2 |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N'-[1-[(2R)-butan-2-yl]-5-methylpyrazol-3-yl]-N-(5-chloro-2-fluorophenyl)oxamide |
| SMILES | CC[C@@H](C)n1nc(NC(=O)C(=O)Nc2cc(Cl)ccc2F)cc1C |
| InChI | InChI=1S/C16H18ClFN4O2/c1-4-9(2)22-10(3)7-14(21-22)20-16(24)15(23)19-13-8-11(17)5-6-12(13)18/h5-9H,4H2,1-3H3,(H,19,23)(H,20,21,24)/t9-/m1/s1 |
| InChIKey | RNCFJZGZBDNWCW-SECBINFHSA-N |
| XLogP | 3.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|