C13H15N3O4S2 — CID 99802853
2-(4-nitrophenyl)-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]ethanesulfonamide (PubChem CID 99802853) has the molecular formula C13H15N3O4S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 2-(4-nitrophenyl)-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]ethanesulfonamide.
| Compound Name | 2-(4-nitrophenyl)-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 99802853 |
| Molecular Formula | C13H15N3O4S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-(4-nitrophenyl)-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]ethanesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)CCc1ccc([N+](=O)[O-])cc1)c1cncs1 |
| InChI | InChI=1S/C13H15N3O4S2/c1-10(13-8-14-9-21-13)15-22(19,20)7-6-11-2-4-12(5-3-11)16(17)18/h2-5,8-10,15H,6-7H2,1H3/t10-/m0/s1 |
| InChIKey | HPFRBSBQJMTZAL-JTQLQIEISA-N |
| XLogP | 2.27 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|