C17H31NO2 — CID 99808546
(2S)-N-cycloheptyl-2-[(1R,3R)-3-methylcyclohexyl]oxypropanamide (PubChem CID 99808546) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is (2S)-N-cycloheptyl-2-[(1R,3R)-3-methylcyclohexyl]oxypropanamide.
| Compound Name | (2S)-N-cycloheptyl-2-[(1R,3R)-3-methylcyclohexyl]oxypropanamide |
|---|---|
| PubChem CID | 99808546 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | (2S)-N-cycloheptyl-2-[(1R,3R)-3-methylcyclohexyl]oxypropanamide |
| SMILES | C[C@@H]1CCC[C@@H](O[C@@H](C)C(=O)NC2CCCCCC2)C1 |
| InChI | InChI=1S/C17H31NO2/c1-13-8-7-11-16(12-13)20-14(2)17(19)18-15-9-5-3-4-6-10-15/h13-16H,3-12H2,1-2H3,(H,18,19)/t13-,14+,16-/m1/s1 |
| InChIKey | GIQUYTLZSGUQLU-IJEWVQPXSA-N |
| XLogP | 3.81 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |