C19H26N2O4 — CID 99810315
N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N,3-dimethyl-2-nitrobenzamide (PubChem CID 99810315) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N,3-dimethyl-2-nitrobenzamide.
| Compound Name | N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N,3-dimethyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 99810315 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N,3-dimethyl-2-nitrobenzamide |
| SMILES | CCO[C@@H]1C[C@H](N(C)C(=O)c2cccc(C)c2[N+](=O)[O-])C12CCCC2 |
| InChI | InChI=1S/C19H26N2O4/c1-4-25-16-12-15(19(16)10-5-6-11-19)20(3)18(22)14-9-7-8-13(2)17(14)21(23)24/h7-9,15-16H,4-6,10-12H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | LFWNSCOSGHLVMI-JKSUJKDBSA-N |
| XLogP | 3.71 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|