C21H27N3O4 — CID 99697666
N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide (PubChem CID 99697666) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide.
| Compound Name | N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 99697666 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | N-[(1R,3R)-3-ethoxyspiro[3.5]nonan-1-yl]-N-methyl-2,3-dioxo-1,4-dihydroquinoxaline-6-carboxamide |
| SMILES | CCO[C@@H]1C[C@@H](N(C)C(=O)c2ccc3[nH]c(=O)c(=O)[nH]c3c2)C12CCCCC2 |
| InChI | InChI=1S/C21H27N3O4/c1-3-28-17-12-16(21(17)9-5-4-6-10-21)24(2)20(27)13-7-8-14-15(11-13)23-19(26)18(25)22-14/h7-8,11,16-17H,3-6,9-10,12H2,1-2H3,(H,22,25)(H,23,26)/t16-,17-/m1/s1 |
| InChIKey | GFCUYEIOUKUGMC-IAGOWNOFSA-N |
| XLogP | 2.42 |
| TPSA | 95.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|