C20H25N3O4 — CID 99810410
N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N-methyl-5-nitro-1H-indole-3-carboxamide (PubChem CID 99810410) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N-methyl-5-nitro-1H-indole-3-carboxamide.
| Compound Name | N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N-methyl-5-nitro-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 99810410 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[(1S,3R)-3-ethoxyspiro[3.4]octan-1-yl]-N-methyl-5-nitro-1H-indole-3-carboxamide |
| SMILES | CCO[C@@H]1C[C@H](N(C)C(=O)c2c[nH]c3ccc([N+](=O)[O-])cc23)C12CCCC2 |
| InChI | InChI=1S/C20H25N3O4/c1-3-27-18-11-17(20(18)8-4-5-9-20)22(2)19(24)15-12-21-16-7-6-13(23(25)26)10-14(15)16/h6-7,10,12,17-18,21H,3-5,8-9,11H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | VRQJYVMPXSIUSI-ZWKOTPCHSA-N |
| XLogP | 3.89 |
| TPSA | 88.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|