About 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea
1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea (PubChem CID 99810590) has the molecular formula C19H17ClN4O
and a molecular weight of 352.83 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea.
Molecular Properties
| Compound Name | 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea |
| PubChem CID | 99810590 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea |
| SMILES | O=C(Nc1ccn(-c2ccccc2)n1)N[C@H]1C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H17ClN4O/c20-14-6-4-5-13(11-14)16-12-17(16)21-19(25)22-18-9-10-24(23-18)15-7-2-1-3-8-15/h1-11,16-17H,12H2,(H2,21,22,23,25)/t16-,17+/m1/s1 |
| InChIKey | AEELIOIYEXJNHI-SJORKVTESA-N |
| XLogP | 4.20 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea?
The IUPAC name of 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea (CID 99810590) is 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea.
What is the SMILES notation for 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea?
The canonical SMILES for 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea is O=C(Nc1ccn(-c2ccccc2)n1)N[C@H]1C[C@@H]1c1cccc(Cl)c1.
What is the InChIKey of 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea?
The InChIKey is AEELIOIYEXJNHI-SJORKVTESA-N. The full InChI is InChI=1S/C19H17ClN4O/c20-14-6-4-5-13(11-14)16-12-17(16)21-19(25)22-18-9-10-24(23-18)15-7-2-1-3-8-15/h1-11,16-17H,12H2,(H2,21,22,23,25)/t16-,17+/m1/s1.
What are the key properties of 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea?
1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea has a molecular weight of 352.83 g/mol, XLogP of 4.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-(1-phenylpyrazol-3-yl)urea is sourced from PubChem (CID 99810590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).