C18H21F2NO2 — CID 99811943
2-[[[(2S)-2-(2,4-difluorophenyl)-2-hydroxypropyl]amino]methyl]-4,5-dimethylphenol (PubChem CID 99811943) has the molecular formula C18H21F2NO2 and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[[[(2S)-2-(2,4-difluorophenyl)-2-hydroxypropyl]amino]methyl]-4,5-dimethylphenol.
| Compound Name | 2-[[[(2S)-2-(2,4-difluorophenyl)-2-hydroxypropyl]amino]methyl]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 99811943 |
| Molecular Formula | C18H21F2NO2 |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-[[[(2S)-2-(2,4-difluorophenyl)-2-hydroxypropyl]amino]methyl]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(CNC[C@@](C)(O)c2ccc(F)cc2F)cc1C |
| InChI | InChI=1S/C18H21F2NO2/c1-11-6-13(17(22)7-12(11)2)9-21-10-18(3,23)15-5-4-14(19)8-16(15)20/h4-8,21-23H,9-10H2,1-3H3/t18-/m1/s1 |
| InChIKey | KUGGPNNVZPTDTO-GOSISDBHSA-N |
| XLogP | 3.28 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|