C24H28N2O3 — CID 99812159
(5S)-7-[(2S)-2-(2-ethylphenoxy)-2-phenylacetyl]-2,7-diazaspiro[4.5]decan-3-one (PubChem CID 99812159) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is (5S)-7-[(2S)-2-(2-ethylphenoxy)-2-phenylacetyl]-2,7-diazaspiro[4.5]decan-3-one.
| Compound Name | (5S)-7-[(2S)-2-(2-ethylphenoxy)-2-phenylacetyl]-2,7-diazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 99812159 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | (5S)-7-[(2S)-2-(2-ethylphenoxy)-2-phenylacetyl]-2,7-diazaspiro[4.5]decan-3-one |
| SMILES | CCc1ccccc1O[C@H](C(=O)N1CCC[C@]2(CNC(=O)C2)C1)c1ccccc1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-18-9-6-7-12-20(18)29-22(19-10-4-3-5-11-19)23(28)26-14-8-13-24(17-26)15-21(27)25-16-24/h3-7,9-12,22H,2,8,13-17H2,1H3,(H,25,27)/t22-,24-/m0/s1 |
| InChIKey | OJIQHNUVTZFAMO-UPVQGACJSA-N |
| XLogP | 3.50 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |