C19H25N3O3S — CID 99813188
2,2-dimethyl-N-[[(3S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-3-yl]methyl]propanamide (PubChem CID 99813188) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is 2,2-dimethyl-N-[[(3S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-3-yl]methyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[[(3S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-3-yl]methyl]propanamide |
|---|---|
| PubChem CID | 99813188 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 2,2-dimethyl-N-[[(3S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-3-yl]methyl]propanamide |
| SMILES | CC(C)(C)C(=O)NC[C@@H]1CCCN(C(=O)c2ccc3[nH]c(=S)oc3c2)C1 |
| InChI | InChI=1S/C19H25N3O3S/c1-19(2,3)17(24)20-10-12-5-4-8-22(11-12)16(23)13-6-7-14-15(9-13)25-18(26)21-14/h6-7,9,12H,4-5,8,10-11H2,1-3H3,(H,20,24)(H,21,26)/t12-/m0/s1 |
| InChIKey | UMFZMRYLKMKKNX-LBPRGKRZSA-N |
| XLogP | 3.50 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|