C15H17N3O3S — CID 99564778
2-[(2S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-2-yl]acetamide (PubChem CID 99564778) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is 2-[(2S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-2-yl]acetamide.
| Compound Name | 2-[(2S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-2-yl]acetamide |
|---|---|
| PubChem CID | 99564778 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 2-[(2S)-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidin-2-yl]acetamide |
| SMILES | NC(=O)C[C@@H]1CCCCN1C(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C15H17N3O3S/c16-13(19)8-10-3-1-2-6-18(10)14(20)9-4-5-11-12(7-9)21-15(22)17-11/h4-5,7,10H,1-3,6,8H2,(H2,16,19)(H,17,22)/t10-/m0/s1 |
| InChIKey | MAVHTJKFINDRBD-JTQLQIEISA-N |
| XLogP | 2.36 |
| TPSA | 92.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|