C19H25N3O3S — CID 99811792
(3S,6R)-N-butyl-6-methyl-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-3-carboxamide (PubChem CID 99811792) has the molecular formula C19H25N3O3S and a molecular weight of 375.49 g/mol. Its IUPAC name is (3S,6R)-N-butyl-6-methyl-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-3-carboxamide.
| Compound Name | (3S,6R)-N-butyl-6-methyl-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 99811792 |
| Molecular Formula | C19H25N3O3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (3S,6R)-N-butyl-6-methyl-1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CC[C@@H](C)N(C(=O)c2ccc3[nH]c(=S)oc3c2)C1 |
| InChI | InChI=1S/C19H25N3O3S/c1-3-4-9-20-17(23)14-6-5-12(2)22(11-14)18(24)13-7-8-15-16(10-13)25-19(26)21-15/h7-8,10,12,14H,3-6,9,11H2,1-2H3,(H,20,23)(H,21,26)/t12-,14+/m1/s1 |
| InChIKey | OWUVQLLLJDCQFZ-OCCSQVGLSA-N |
| XLogP | 3.65 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|