C21H30N4O4S — CID 52511534
(3S,6R)-N-butyl-1-[4-(2-cyanoethylsulfamoyl)benzoyl]-6-methylpiperidine-3-carboxamide (PubChem CID 52511534) has the molecular formula C21H30N4O4S and a molecular weight of 434.56 g/mol. Its IUPAC name is (3S,6R)-N-butyl-1-[4-(2-cyanoethylsulfamoyl)benzoyl]-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6R)-N-butyl-1-[4-(2-cyanoethylsulfamoyl)benzoyl]-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 52511534 |
| Molecular Formula | C21H30N4O4S |
| Molecular Weight | 434.56 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | (3S,6R)-N-butyl-1-[4-(2-cyanoethylsulfamoyl)benzoyl]-6-methylpiperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@H]1CC[C@@H](C)N(C(=O)c2ccc(S(=O)(=O)NCCC#N)cc2)C1 |
| InChI | InChI=1S/C21H30N4O4S/c1-3-4-13-23-20(26)18-7-6-16(2)25(15-18)21(27)17-8-10-19(11-9-17)30(28,29)24-14-5-12-22/h8-11,16,18,24H,3-7,13-15H2,1-2H3,(H,23,26)/t16-,18+/m1/s1 |
| InChIKey | OZLOLILGISDPOB-AEFFLSMTSA-N |
| XLogP | 2.04 |
| TPSA | 119.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.56 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|