C18H22N2O4S — CID 119033591
tert-butyl 1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-2-carboxylate (PubChem CID 119033591) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is tert-butyl 1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-2-carboxylate.
| Compound Name | tert-butyl 1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-2-carboxylate |
|---|---|
| PubChem CID | 119033591 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | tert-butyl 1-(2-sulfanylidene-3H-1,3-benzoxazole-6-carbonyl)piperidine-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCCN1C(=O)c1ccc2[nH]c(=S)oc2c1 |
| InChI | InChI=1S/C18H22N2O4S/c1-18(2,3)24-16(22)13-6-4-5-9-20(13)15(21)11-7-8-12-14(10-11)23-17(25)19-12/h7-8,10,13H,4-6,9H2,1-3H3,(H,19,25) |
| InChIKey | HXTBUIAJLXRGSV-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 75.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|