About 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine
5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine (PubChem CID 99813703) has the molecular formula C14H14ClN3
and a molecular weight of 259.74 g/mol. Its IUPAC name is 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine |
| PubChem CID | 99813703 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine |
| SMILES | CN(c1ncc(Cl)cn1)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C14H14ClN3/c1-18(14-16-8-11(15)9-17-14)13-7-6-10-4-2-3-5-12(10)13/h2-5,8-9,13H,6-7H2,1H3/t13-/m0/s1 |
| InChIKey | QRMRCEUEOPBRMI-ZDUSSCGKSA-N |
| XLogP | 3.25 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine?
The IUPAC name of 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine (CID 99813703) is 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine.
What is the SMILES notation for 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine?
The canonical SMILES for 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine is CN(c1ncc(Cl)cn1)[C@H]1CCc2ccccc21.
What is the InChIKey of 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine?
The InChIKey is QRMRCEUEOPBRMI-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H14ClN3/c1-18(14-16-8-11(15)9-17-14)13-7-6-10-4-2-3-5-12(10)13/h2-5,8-9,13H,6-7H2,1H3/t13-/m0/s1.
What are the key properties of 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine?
5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine has a molecular weight of 259.74 g/mol, XLogP of 3.25, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(1S)-2,3-dihydro-1H-inden-1-yl]-N-methylpyrimidin-2-amine is sourced from PubChem (CID 99813703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).