C23H24F2N4O3 — CID 99815932
4-(2,4-difluorophenoxy)-1-[(2R,4R)-4-methoxy-2-(5-pyridin-3-yl-1H-imidazol-2-yl)pyrrolidin-1-yl]butan-1-one (PubChem CID 99815932) has the molecular formula C23H24F2N4O3 and a molecular weight of 442.47 g/mol. Its IUPAC name is 4-(2,4-difluorophenoxy)-1-[(2R,4R)-4-methoxy-2-(5-pyridin-3-yl-1H-imidazol-2-yl)pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4-(2,4-difluorophenoxy)-1-[(2R,4R)-4-methoxy-2-(5-pyridin-3-yl-1H-imidazol-2-yl)pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 99815932 |
| Molecular Formula | C23H24F2N4O3 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | 4-(2,4-difluorophenoxy)-1-[(2R,4R)-4-methoxy-2-(5-pyridin-3-yl-1H-imidazol-2-yl)pyrrolidin-1-yl]butan-1-one |
| SMILES | CO[C@@H]1C[C@H](c2ncc(-c3cccnc3)[nH]2)N(C(=O)CCCOc2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C23H24F2N4O3/c1-31-17-11-20(23-27-13-19(28-23)15-4-2-8-26-12-15)29(14-17)22(30)5-3-9-32-21-7-6-16(24)10-18(21)25/h2,4,6-8,10,12-13,17,20H,3,5,9,11,14H2,1H3,(H,27,28)/t17-,20-/m1/s1 |
| InChIKey | UJWSFBBTPCUMGX-YLJYHZDGSA-N |
| XLogP | 3.90 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|