C13H18FN3O4S — CID 99815993
N-[(1R,2R)-2-(aminomethyl)cyclohexyl]-3-fluoro-5-nitrobenzenesulfonamide (PubChem CID 99815993) has the molecular formula C13H18FN3O4S and a molecular weight of 331.37 g/mol. Its IUPAC name is N-[(1R,2R)-2-(aminomethyl)cyclohexyl]-3-fluoro-5-nitrobenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-(aminomethyl)cyclohexyl]-3-fluoro-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 99815993 |
| Molecular Formula | C13H18FN3O4S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[(1R,2R)-2-(aminomethyl)cyclohexyl]-3-fluoro-5-nitrobenzenesulfonamide |
| SMILES | NC[C@H]1CCCC[C@H]1NS(=O)(=O)c1cc(F)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18FN3O4S/c14-10-5-11(17(18)19)7-12(6-10)22(20,21)16-13-4-2-1-3-9(13)8-15/h5-7,9,13,16H,1-4,8,15H2/t9-,13-/m1/s1 |
| InChIKey | MXZFDMDWNQPYMA-NOZJJQNGSA-N |
| XLogP | 1.53 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|