C20H32N4O4S — CID 99816141
N-methyl-N-[(1S,2S)-2-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexyl]-2-nitrobenzenesulfonamide (PubChem CID 99816141) has the molecular formula C20H32N4O4S and a molecular weight of 424.57 g/mol. Its IUPAC name is N-methyl-N-[(1S,2S)-2-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-methyl-N-[(1S,2S)-2-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 99816141 |
| Molecular Formula | C20H32N4O4S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-methyl-N-[(1S,2S)-2-[methyl-(1-methylpiperidin-4-yl)amino]cyclohexyl]-2-nitrobenzenesulfonamide |
| SMILES | CN1CCC(N(C)[C@H]2CCCC[C@@H]2N(C)S(=O)(=O)c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H32N4O4S/c1-21-14-12-16(13-15-21)22(2)17-8-4-5-9-18(17)23(3)29(27,28)20-11-7-6-10-19(20)24(25)26/h6-7,10-11,16-18H,4-5,8-9,12-15H2,1-3H3/t17-,18-/m0/s1 |
| InChIKey | KJPLVBLDMVFXFT-ROUUACIJSA-N |
| XLogP | 2.55 |
| TPSA | 87.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|