C14H17BrN2O5S — CID 11429627
N-(2-bromo-3-oxopropyl)-N-cyclopentyl-2-nitrobenzenesulfonamide (PubChem CID 11429627) has the molecular formula C14H17BrN2O5S and a molecular weight of 405.27 g/mol. Its IUPAC name is N-(2-bromo-3-oxopropyl)-N-cyclopentyl-2-nitrobenzenesulfonamide.
| Compound Name | N-(2-bromo-3-oxopropyl)-N-cyclopentyl-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 11429627 |
| Molecular Formula | C14H17BrN2O5S |
| Molecular Weight | 405.27 g/mol |
| Exact Mass | 404.00 |
| IUPAC Name | N-(2-bromo-3-oxopropyl)-N-cyclopentyl-2-nitrobenzenesulfonamide |
| SMILES | O=CC(Br)CN(C1CCCC1)S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17BrN2O5S/c15-11(10-18)9-16(12-5-1-2-6-12)23(21,22)14-8-4-3-7-13(14)17(19)20/h3-4,7-8,10-12H,1-2,5-6,9H2 |
| InChIKey | QMLIJHYNZQSQAR-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|