C19H23N3O — CID 99816656
N-[3-[(4-ethyl-2,3-dihydroquinoxalin-1-yl)methyl]phenyl]acetamide (PubChem CID 99816656) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[3-[(4-ethyl-2,3-dihydroquinoxalin-1-yl)methyl]phenyl]acetamide.
| Compound Name | N-[3-[(4-ethyl-2,3-dihydroquinoxalin-1-yl)methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 99816656 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[3-[(4-ethyl-2,3-dihydroquinoxalin-1-yl)methyl]phenyl]acetamide |
| SMILES | CCN1CCN(Cc2cccc(NC(C)=O)c2)c2ccccc21 |
| InChI | InChI=1S/C19H23N3O/c1-3-21-11-12-22(19-10-5-4-9-18(19)21)14-16-7-6-8-17(13-16)20-15(2)23/h4-10,13H,3,11-12,14H2,1-2H3,(H,20,23) |
| InChIKey | ZCPOVUDNIGEWIK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |