About N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide
N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide (PubChem CID 120762205) has the molecular formula C19H23N3O
and a molecular weight of 309.41 g/mol. Its IUPAC name is N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide |
| PubChem CID | 120762205 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(CN2C[C@@H](N)[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C19H23N3O/c1-14(23)21-17-9-5-6-15(10-17)11-22-12-18(19(20)13-22)16-7-3-2-4-8-16/h2-10,18-19H,11-13,20H2,1H3,(H,21,23)/t18-,19+/m0/s1 |
| InChIKey | VAHVHJFVPIOPAA-RBUKOAKNSA-N |
| XLogP | 2.57 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide?
The IUPAC name of N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide (CID 120762205) is N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide.
What is the SMILES notation for N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide?
The canonical SMILES for N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide is CC(=O)Nc1cccc(CN2C[C@@H](N)[C@H](c3ccccc3)C2)c1.
What is the InChIKey of N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide?
The InChIKey is VAHVHJFVPIOPAA-RBUKOAKNSA-N. The full InChI is InChI=1S/C19H23N3O/c1-14(23)21-17-9-5-6-15(10-17)11-22-12-18(19(20)13-22)16-7-3-2-4-8-16/h2-10,18-19H,11-13,20H2,1H3,(H,21,23)/t18-,19+/m0/s1.
What are the key properties of N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide?
N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide has a molecular weight of 309.41 g/mol, XLogP of 2.57, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[[(3S,4R)-3-amino-4-phenylpyrrolidin-1-yl]methyl]phenyl]acetamide is sourced from PubChem (CID 120762205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).