C23H23N5O — CID 99817337
1-benzyl-5-methyl-N-[1-methyl-3-(2-methylphenyl)pyrazol-5-yl]pyrazole-4-carboxamide (PubChem CID 99817337) has the molecular formula C23H23N5O and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-benzyl-5-methyl-N-[1-methyl-3-(2-methylphenyl)pyrazol-5-yl]pyrazole-4-carboxamide.
| Compound Name | 1-benzyl-5-methyl-N-[1-methyl-3-(2-methylphenyl)pyrazol-5-yl]pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 99817337 |
| Molecular Formula | C23H23N5O |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 1-benzyl-5-methyl-N-[1-methyl-3-(2-methylphenyl)pyrazol-5-yl]pyrazole-4-carboxamide |
| SMILES | Cc1ccccc1-c1cc(NC(=O)c2cnn(Cc3ccccc3)c2C)n(C)n1 |
| InChI | InChI=1S/C23H23N5O/c1-16-9-7-8-12-19(16)21-13-22(27(3)26-21)25-23(29)20-14-24-28(17(20)2)15-18-10-5-4-6-11-18/h4-14H,15H2,1-3H3,(H,25,29) |
| InChIKey | YETKLZRVVYTTFT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |