C13H14FN3O4S — CID 99822253
2-fluoro-5-methyl-3-[(2-methylpyrazol-3-yl)methylsulfamoyl]benzoic acid (PubChem CID 99822253) has the molecular formula C13H14FN3O4S and a molecular weight of 327.34 g/mol. Its IUPAC name is 2-fluoro-5-methyl-3-[(2-methylpyrazol-3-yl)methylsulfamoyl]benzoic acid.
| Compound Name | 2-fluoro-5-methyl-3-[(2-methylpyrazol-3-yl)methylsulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 99822253 |
| Molecular Formula | C13H14FN3O4S |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-fluoro-5-methyl-3-[(2-methylpyrazol-3-yl)methylsulfamoyl]benzoic acid |
| SMILES | Cc1cc(C(=O)O)c(F)c(S(=O)(=O)NCc2ccnn2C)c1 |
| InChI | InChI=1S/C13H14FN3O4S/c1-8-5-10(13(18)19)12(14)11(6-8)22(20,21)16-7-9-3-4-15-17(9)2/h3-6,16H,7H2,1-2H3,(H,18,19) |
| InChIKey | FWZCRNOCKNCLFQ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |