C15H17NO3 — CID 99824050
[(2R)-but-3-en-2-yl] 4-(cyclopropylcarbamoyl)benzoate (PubChem CID 99824050) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is [(2R)-but-3-en-2-yl] 4-(cyclopropylcarbamoyl)benzoate.
| Compound Name | [(2R)-but-3-en-2-yl] 4-(cyclopropylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 99824050 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [(2R)-but-3-en-2-yl] 4-(cyclopropylcarbamoyl)benzoate |
| SMILES | C=C[C@@H](C)OC(=O)c1ccc(C(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C15H17NO3/c1-3-10(2)19-15(18)12-6-4-11(5-7-12)14(17)16-13-8-9-13/h3-7,10,13H,1,8-9H2,2H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | BDXHUPIEDAGUJY-SNVBAGLBSA-N |
| XLogP | 2.31 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|