C16H21N3O3 — CID 99825759
2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]acetamide (PubChem CID 99825759) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 99825759 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[(1R)-1-(2-hydroxy-5-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(O)c([C@@H](C)NC(=O)Cc2c(C)n[nH]c2C)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-9(14-7-12(22-4)5-6-15(14)20)17-16(21)8-13-10(2)18-19-11(13)3/h5-7,9,20H,8H2,1-4H3,(H,17,21)(H,18,19)/t9-/m1/s1 |
| InChIKey | BDZIFECQBDHYPS-SECBINFHSA-N |
| XLogP | 2.16 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|