C17H18N4O4 — CID 99825931
[3-(4-nitrophenoxy)azetidin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone (PubChem CID 99825931) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is [3-(4-nitrophenoxy)azetidin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone.
| Compound Name | [3-(4-nitrophenoxy)azetidin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 99825931 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | [3-(4-nitrophenoxy)azetidin-1-yl]-(4,5,6,7-tetrahydro-1H-indazol-3-yl)methanone |
| SMILES | O=C(c1n[nH]c2c1CCCC2)N1CC(Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H18N4O4/c22-17(16-14-3-1-2-4-15(14)18-19-16)20-9-13(10-20)25-12-7-5-11(6-8-12)21(23)24/h5-8,13H,1-4,9-10H2,(H,18,19) |
| InChIKey | IWAWODUMUXXIQA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 101.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|