C14H16N2O4 — CID 99826015
[(1R,2S)-2-methylcyclopropyl]-[3-(4-nitrophenoxy)azetidin-1-yl]methanone (PubChem CID 99826015) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is [(1R,2S)-2-methylcyclopropyl]-[3-(4-nitrophenoxy)azetidin-1-yl]methanone.
| Compound Name | [(1R,2S)-2-methylcyclopropyl]-[3-(4-nitrophenoxy)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 99826015 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | [(1R,2S)-2-methylcyclopropyl]-[3-(4-nitrophenoxy)azetidin-1-yl]methanone |
| SMILES | C[C@H]1C[C@H]1C(=O)N1CC(Oc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C14H16N2O4/c1-9-6-13(9)14(17)15-7-12(8-15)20-11-4-2-10(3-5-11)16(18)19/h2-5,9,12-13H,6-8H2,1H3/t9-,13+/m0/s1 |
| InChIKey | WKGXAILQYCTNTJ-TVQRCGJNSA-N |
| XLogP | 1.84 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|