C19H24N2O2 — CID 99826380
N-[(2S)-2-benzyl-3-methylbutyl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide (PubChem CID 99826380) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-[(2S)-2-benzyl-3-methylbutyl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide.
| Compound Name | N-[(2S)-2-benzyl-3-methylbutyl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 99826380 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-[(2S)-2-benzyl-3-methylbutyl]-4-methyl-6-oxo-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(=O)[nH]cc1C(=O)NC[C@@H](Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C19H24N2O2/c1-13(2)16(10-15-7-5-4-6-8-15)11-21-19(23)17-12-20-18(22)9-14(17)3/h4-9,12-13,16H,10-11H2,1-3H3,(H,20,22)(H,21,23)/t16-/m1/s1 |
| InChIKey | PSNKRYMRDFRBBL-MRXNPFEDSA-N |
| XLogP | 2.93 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |